ED-NDMA
1-(2,3-Dihydro-1,4-benzodioxin-6-yl)-N,N-dimethylpropan-2-amine
 6802 C13H19NO2 221.295
 InChI=1S/C13H19NO2/c1-10(14(2)3)8-11-4-5-12-13(9-11)16-7-6-15-12/h4-5,9-10H,6-8H2,1-3H3
 MOSUXZZBTULFFM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(C(Cc1ccc2c(c1)OCCO2)C)C