ED-mor-PEA
4-[2-(2,3-Dihydro-1,4-benzodioxin-6-yl)ethyl]morpholine
 6786  C14H19NO3  249.306
 InChI=1S/C14H19NO3/c1-2-13-14(18-10-9-17-13)11-12(1)3-4-15-5-7-16-8-6-15/h1-2,11H,3-10H2
 PEHTXJTWOUDUNB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 O1CCN(CC1)CCc1ccc2c(c1)OCCO2