PRONE
1-(2H-1,3-Benzodioxol-5-yl)-2-[(prop-2-yn-1-yl)amino]propan-1-one
 6723  C13H13NO3  231.247
 InChI=1S/C13H13NO3/c1-3-6-14-9(2)13(15)10-4-5-11-12(7-10)17-8-16-11/h1,4-5,7,9,14H,6,8H2,2H3
 IJMQPNRGFWIOAL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C#CCNC(C(=O)c1ccc2c(c1)OCO2)C