MMTA
1-[3-Methyl-4-(methylsulfanyl)phenyl]propan-2-amine
 6658  C11H17NS  195.324
 InChI=1S/C11H17NS/c1-8-6-10(7-9(2)12)4-5-11(8)13-3/h4-6,9H,7,12H2,1-3H3
 DIPXMSSKSUKLDH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CSc1ccc(cc1C)CC(N)C