DEA
1-(3,4-Diethoxyphenyl)propan-2-amine
 6656 C13H21NO2 223.311
 InChI=1S/C13H21NO2/c1-4-15-12-7-6-11(8-10(3)14)9-13(12)16-5-2/h6-7,9-10H,4-5,8,14H2,1-3H3
 AZDKIWDNHVWQDL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1cc(ccc1OCC)CC(N)C