MEA
1-(4-Ethoxy-3-methoxyphenyl)propan-2-amine
 6651 C12H19NO2 209.285
 InChI=1S/C12H19NO2/c1-4-15-11-6-5-10(7-9(2)13)8-12(11)14-3/h5-6,8-9H,4,7,13H2,1-3H3
 RVWFZIVXDDQMII-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1ccc(cc1OC)CC(N)C