2″-Me-PCP
2-Methyl-1-(1-phenylcyclohexyl)piperidine
 6638 C18H27N 257.414
 Arylcycloalkylamine
 InChI=1S/C18H27N/c1-16-10-6-9-15-19(16)18(13-7-3-8-14-18)17-11-4-2-5-12-17/h2,4-5,11-12,16H,3,6-10,13-15H2,1H3
 KEFOJJFDCYBIPC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC1CCCCN1C1(CCCCC1)c1ccccc1