N-Me-HMPEA
2-Methoxy-5-[2-(methylamino)ethyl]phenol
 6580 C10H15NO2 181.232
 InChI=1S/C10H15NO2/c1-11-6-5-8-3-4-10(13-2)9(12)7-8/h3-4,7,11-12H,5-6H2,1-2H3
 RXFHZXFNOINZJF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNCCc1ccc(c(c1)O)OC