N-Me-3-Cl-MPEA
2-(3-Chloro-4-methoxyphenyl)-N-methylethan-1-amine
 6573  C10H14ClNO  199.677
 InChI=1S/C10H14ClNO/c1-12-6-5-8-3-4-10(13-2)9(11)7-8/h3-4,7,12H,5-6H2,1-2H3
 GWJJXZYENDISEN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNCCc1ccc(c(c1)Cl)OC