MHAOH
4-[2-(Hydroxyamino)propyl]-2-methoxyphenol
 6563 C10H15NO3 197.231
 InChI=1S/C10H15NO3/c1-7(11-13)5-8-3-4-9(12)10(6-8)14-2/h3-4,6-7,11-13H,5H2,1-2H3
 APXXOAPQKHNREL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 ONC(Cc1ccc(c(c1)OC)O)C