Metanephrine
4-[1-Hydroxy-2-(methylamino)ethyl]-2-methoxyphenol
 6558 C10H15NO3 197.231
 InChI=1S/C10H15NO3/c1-11-6-9(13)7-3-4-8(12)10(5-7)14-2/h3-5,9,11-13H,6H2,1-2H3
 JWJCTZKFYGDABJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNCC(c1ccc(c(c1)OC)O)O