Benzoylcyclohexylpiperidine
Phenyl[1-(piperidin-1-yl)cyclohexyl]methanone
 6542 C18H25NO 271.397
 Arylcycloalkylamine
 InChI=1S/C18H25NO/c20-17(16-10-4-1-5-11-16)18(12-6-2-7-13-18)19-14-8-3-9-15-19/h1,4-5,10-11H,2-3,6-9,12-15H2
 IAOAMKAFYWGNKY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 O=C(C1(CCCCC1)N1CCCCC1)c1ccccc1