DHMAOH
4-{2-[Hydroxy(methyl)amino]propyl}benzene-1,2-diol
 6529 C10H15NO3 197.231
 InChI=1S/C10H15NO3/c1-7(11(2)14)5-8-3-4-9(12)10(13)6-8/h3-4,6-7,12-14H,5H2,1-2H3
 GOQYYVGPQUFNCY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(C(Cc1ccc(c(c1)O)O)C)O