DHAOH
4-[2-(Hydroxyamino)propyl]benzene-1,2-diol
 6527  C9H13NO3  183.204
 InChI=1S/C9H13NO3/c1-6(10-13)4-7-2-3-8(11)9(12)5-7/h2-3,5-6,10-13H,4H2,1H3
 IKBIYXACJDZMFU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 ONC(Cc1ccc(c(c1)O)O)C