β,3,4-HO-N-Et-PEA
4-[2-(Ethylamino)-1-hydroxyethyl]benzene-1,2-diol
 6521 C10H15NO3 197.231
 InChI=1S/C10H15NO3/c1-2-11-6-10(14)7-3-4-8(12)9(13)5-7/h3-5,10-14H,2,6H2,1H3
 IYLZZNHDXBTZMO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNCC(c1ccc(c(c1)O)O)O