3-Cl-4-HPEA
4-(2-Aminoethyl)-2-chlorophenol
 6506  C8H10ClNO  171.624
 InChI=1S/C8H10ClNO/c9-7-5-6(3-4-10)1-2-8(7)11/h1-2,5,11H,3-4,10H2
 VATRCWZBGYJZOX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1ccc(c(c1)Cl)O