3-Br-PHA
4-(2-Aminopropyl)-2-bromophenol
 6505  C9H12BrNO  230.102
 InChI=1S/C9H12BrNO/c1-6(11)4-7-2-3-9(12)8(10)5-7/h2-3,5-6,12H,4,11H2,1H3
 DIBBHKXBNUUUOA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccc(c(c1)Br)O)N