N-Me-DCA
1-(3,4-Dichlorophenyl)-N-methylpropan-2-amine
 6472  C10H13Cl2N  218.123
 InChI=1S/C10H13Cl2N/c1-7(13-2)5-8-3-4-9(11)10(12)6-8/h3-4,6-7,13H,5H2,1-2H3
 AMVQDYOQPWIBPF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(Cc1ccc(c(c1)Cl)Cl)C