DCPEA
2-(3,4-Dichlorophenyl)ethan-1-amine
 6470  C8H9Cl2N  190.07
 InChI=1S/C8H9Cl2N/c9-7-2-1-6(3-4-11)5-8(7)10/h1-2,5H,3-4,11H2
 MQPUAVYKVIHUJP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1ccc(c(c1)Cl)Cl