MTAI
5-(Methylsulfanyl)-2,3-dihydro-1H-inden-2-amine
 6467  C10H13NS  179.282
 InChI=1S/C10H13NS/c1-12-10-3-2-7-4-9(11)5-8(7)6-10/h2-3,6,9H,4-5,11H2,1H3
 IXPFURSRCMUMCP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CSc1ccc2c(c1)CC(C2)N