2,4-DHPEA
4-(2-Aminoethyl)benzene-1,3-diol
 6455 C8H11NO2 153.178
 InChI=1S/C8H11NO2/c9-4-3-6-1-2-7(10)5-8(6)11/h1-2,5,10-11H,3-4,9H2
 URFGSZVXJZMYHZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1ccc(cc1O)O