2,4-DMeA
1-(2,4-Dimethylphenyl)propan-2-amine
 6434 C11H17N 163.259
 InChI=1S/C11H17N/c1-8-4-5-11(7-10(3)12)9(2)6-8/h4-6,10H,7,12H2,1-3H3
 APKRQZWEAZTOTA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccc(cc1C)C)N