4-Br-2-MA
1-(4-Bromo-2-methoxyphenyl)propan-2-amine
 6429 C10H14BrNO 244.128
 InChI=1S/C10H14BrNO/c1-7(12)5-8-3-4-9(11)6-10(8)13-2/h3-4,6-7H,5,12H2,1-2H3
 YWONMRKCBJPFCM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(Br)ccc1CC(N)C