3-HO-PCPr
3-[1-(Propylamino)cyclohexyl]phenol
 6426 C15H23NO 233.349
 InChI=1S/C15H23NO/c1-2-11-16-15(9-4-3-5-10-15)13-7-6-8-14(17)12-13/h6-8,12,16-17H,2-5,9-11H2,1H3
 RSGAAQWNVNYWSG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCNC1(CCCCC1)c1cccc(c1)O