N,N-Me-PCAI
5-Chloro-N,N-dimethyl-2,3-dihydro-1H-inden-2-amine
 6425 C11H14ClN 195.689
 InChI=1S/C11H14ClN/c1-13(2)11-6-8-3-4-10(12)5-9(8)7-11/h3-5,11H,6-7H2,1-2H3
 LAUYMLXKTSDJBL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(C1Cc2c(C1)ccc(c2)Cl)C