PFAI
5-Fluoro-2,3-dihydro-1H-inden-2-amine
 6422 C9H10FN 151.181
 InChI=1S/C9H10FN/c10-8-2-1-6-4-9(11)5-7(6)3-8/h1-3,9H,4-5,11H2
 VAAFFDVGGMHGHW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NC1Cc2c(C1)cc(cc2)F