2,4-DFA
1-(2,4-Difluorophenyl)propan-2-amine
 6421 C9H11F2N 171.187
 InChI=1S/C9H11F2N/c1-6(12)4-7-2-3-8(10)5-9(7)11/h2-3,5-6H,4,12H2,1H3
 IPVBMKZXHICCNW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccc(cc1F)F)N