Amiflamine
4-(2-Aminopropyl)-N,N,3-trimethylaniline
 6420 C12H20N2 192.301
 InChI=1S/C12H20N2/c1-9-7-12(14(3)4)6-5-11(9)8-10(2)13/h5-7,10H,8,13H2,1-4H3
 HFQMYSHATTXRTC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccc(cc1C)N(C)C)N