PNAI
5-Nitro-2,3-dihydro-1H-inden-2-amine
 6419 C9H10N2O2 178.188
 InChI=1S/C9H10N2O2/c10-8-3-6-1-2-9(11(12)13)5-7(6)4-8/h1-2,5,8H,3-4,10H2
 MDRSLNMEVGJERF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NC1Cc2c(C1)cc(cc2)N(=O)=O