N-Me-2,3-EMPEA
2-(2-Ethoxy-3-methoxyphenyl)-N-methylethan-1-amine
 6403 C12H19NO2 209.285
 InChI=1S/C12H19NO2/c1-4-15-12-10(8-9-13-2)6-5-7-11(12)14-3/h5-7,13H,4,8-9H2,1-3H3
 WHFYTSXTIXGYGI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNCCc1cccc(c1OCC)OC