4″-AcO-4″-Ph-TCP
4-Phenyl-1-[1-(thiophen-2-yl)cyclohexyl]piperidin-4-yl acetate
 6393 C23H29NO2S 383.547
 Arylcycloalkylamine
 InChI=1S/C23H29NO2S/c1-19(25)26-23(20-9-4-2-5-10-20)14-16-24(17-15-23)22(12-6-3-7-13-22)21-11-8-18-27-21/h2,4-5,8-11,18H,3,6-7,12-17H2,1H3
 CXMKBFNWRVFOLW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(=O)OC1(CCN(CC1)C1(CCCCC1)c1cccs1)c1ccccc1