4″-AcO-TCP
1-[1-(Thiophen-2-yl)cyclohexyl]piperidin-4-yl acetate
 6389 C17H25NO2S 307.451
 Arylcycloalkylamine
 InChI=1S/C17H25NO2S/c1-14(19)20-15-7-11-18(12-8-15)17(9-3-2-4-10-17)16-6-5-13-21-16/h5-6,13,15H,2-4,7-12H2,1H3
 PXSUUCGSVKHQQQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(=O)OC1CCN(CC1)C1(CCCCC1)c1cccs1