4″-HO-TCP
1-[1-(Thiophen-2-yl)cyclohexyl]piperidin-4-ol
 6388 C15H23NOS 265.414
 Arylcycloalkylamine
 InChI=1S/C15H23NOS/c17-13-6-10-16(11-7-13)15(8-2-1-3-9-15)14-5-4-12-18-14/h4-5,12-13,17H,1-3,6-11H2
 UTEVZHFNJPAKHX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 OC1CCN(CC1)C1(CCCCC1)c1cccs1