BO3M2C
2-(2-Chloro-3-methoxyphenyl)-2-methoxyethan-1-amine
 6375 C10H14ClNO2 215.677
 InChI=1S/C10H14ClNO2/c1-13-8-5-3-4-7(10(8)11)9(6-12)14-2/h3-5,9H,6,12H2,1-2H3
 DISJTWRPQXSKLE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCC(c1cccc(c1Cl)OC)OC