2,3-DHPEA
3-(2-Aminoethyl)benzene-1,2-diol
 6373  C8H11NO2  153.178
 InChI=1S/C8H11NO2/c9-5-4-6-2-1-3-7(10)8(6)11/h1-3,10-11H,4-5,9H2
 SYHVBRQKMHIAJQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cccc(c1O)O