5-HO-PPAT
6-(Dipropylamino)-5,6,7,8-tetrahydronaphthalen-1-ol
 6372 C16H25NO 247.376
 InChI=1S/C16H25NO/c1-3-10-17(11-4-2)14-8-9-15-13(12-14)6-5-7-16(15)18/h5-7,14,18H,3-4,8-12H2,1-2H3
 MDBWEQVKJDMEMK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCN(C1CCc2c(C1)cccc2O)CCC