2,3-HMeMMPEA
2-[2-(Dimethylamino)ethyl]-6-methylphenol
 6365 C11H17NO 179.259
 InChI=1S/C11H17NO/c1-9-5-4-6-10(11(9)13)7-8-12(2)3/h4-6,13H,7-8H2,1-3H3
 FUUSHPZPRNXCBZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CCc1cccc(c1O)C)C