2,3-DMeA
1-(2,3-Dimethylphenyl)propan-2-amine
 6362 C11H17N 163.259
 InChI=1S/C11H17N/c1-8-5-4-6-11(10(8)3)7-9(2)12/h4-6,9H,7,12H2,1-3H3
 HOBBTQMIPDOWRL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1cccc(c1C)C)N