P3MeCPEEt
N-Ethyl-3-methyl-1-phenylcyclopentan-1-amine
 6343 C14H21N 203.323
 Arylcycloalkylamine
 InChI=1S/C14H21N/c1-3-15-14(10-9-12(2)11-14)13-7-5-4-6-8-13/h4-8,12,15H,3,9-11H2,1-2H3
 WZPBKPYNUYSLDE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNC1(CCC(C1)C)c1ccccc1