P2MeCPEEt
N-Ethyl-2-methyl-1-phenylcyclopentan-1-amine
 6342 C14H21N 203.323
 Arylcycloalkylamine
 InChI=1S/C14H21N/c1-3-15-14(11-7-8-12(14)2)13-9-5-4-6-10-13/h4-6,9-10,12,15H,3,7-8,11H2,1-2H3
 GTGUUXNOCSMVAA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNC1(CCCC1C)c1ccccc1