PCPEPr
1-Phenyl-N-propylcyclopentan-1-amine
 6341 C14H21N 203.323
 Arylcycloalkylamine
 InChI=1S/C14H21N/c1-2-12-15-14(10-6-7-11-14)13-8-4-3-5-9-13/h3-5,8-9,15H,2,6-7,10-12H2,1H3
 BUOWDSAFPNAPPC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCNC1(CCCC1)c1ccccc1