4-PPEA
2-(4-Propoxyphenyl)ethan-1-amine
 6325 C11H17NO 179.259
 InChI=1S/C11H17NO/c1-2-9-13-11-5-3-10(4-6-11)7-8-12/h3-6H,2,7-9,12H2,1H3
 SZJABXMYJCXZGW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCOc1ccc(cc1)CCN