α-Et-MPEA
1-(4-Methoxyphenyl)butan-2-amine
 6318 C11H17NO 179.259
 InChI=1S/C11H17NO/c1-3-10(12)8-9-4-6-11(13-2)7-5-9/h4-7,10H,3,8,12H2,1-2H3
 OKQDJBQNHXBFJH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(Cc1ccc(cc1)OC)N