N-iPr-PMA
1-(4-Methoxyphenyl)-N-(propan-2-yl)propan-2-amine
 6315  C13H21NO  207.312
 InChI=1S/C13H21NO/c1-10(2)14-11(3)9-12-5-7-13(15-4)8-6-12/h5-8,10-11,14H,9H2,1-4H3
 ZVXCCHCSWMVPDW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc(cc1)CC(NC(C)C)C