PHMMA
4-[2-(Dimethylamino)propyl]phenol
 6277 C11H17NO 179.259
 InChI=1S/C11H17NO/c1-9(12(2)3)8-10-4-6-11(13)7-5-10/h4-7,9,13H,8H2,1-3H3
 OKQXTKNGCAQTIS-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(N(C)C)Cc1ccc(cc1)O