N-Bu-PHA
4-[2-(Butylamino)propyl]phenol
 6274  C13H21NO  207.312
 InChI=1S/C13H21NO/c1-3-4-9-14-11(2)10-12-5-7-13(15)8-6-12/h5-8,11,14-15H,3-4,9-10H2,1-2H3
 JWHVXZXVROHCRB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCNC(Cc1ccc(cc1)O)C