4-iPPEA
2-[4-(Propan-2-yl)phenyl]ethan-1-amine
 6258 C11H17N 163.259
 InChI=1S/C11H17N/c1-9(2)11-5-3-10(4-6-11)7-8-12/h3-6,9H,7-8,12H2,1-2H3
 ZBLQKSNIFYXZTI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1ccc(cc1)C(C)C