4-PrPEA
2-(4-Propylphenyl)ethan-1-amine
 6256 C11H17N 163.259
 InChI=1S/C11H17N/c1-2-3-10-4-6-11(7-5-10)8-9-12/h4-7H,2-3,8-9,12H2,1H3
 XYWGVXQTEKNATH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCc1ccc(cc1)CCN