4-EtPEA
2-(4-Ethylphenyl)ethan-1-amine
 6255 C10H15N 149.233
 InChI=1S/C10H15N/c1-2-9-3-5-10(6-4-9)7-8-11/h3-6H,2,7-8,11H2,1H3
 XLJAVPNHXCHBPU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1ccc(cc1)CC