DMePAA
N,N-Dimethyl-4-[2-(methylamino)propyl]aniline
 6232  C12H20N2  192.301
 InChI=1S/C12H20N2/c1-10(13-2)9-11-5-7-12(8-6-11)14(3)4/h5-8,10,13H,9H2,1-4H3
 SOQQBXXTGJROJN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(Cc1ccc(cc1)N(C)C)C